C30H31N3O3 — CID 93120122
(3R)-3-(1-benzyl-5-nitroindol-3-yl)-N-cyclohexyl-3-phenylpropanamide (PubChem CID 93120122) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is (3R)-3-(1-benzyl-5-nitroindol-3-yl)-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 93120122 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(C[C@H](c1ccccc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NC1CCCCC1 |
| InChI | InChI=1S/C30H31N3O3/c34-30(31-24-14-8-3-9-15-24)19-26(23-12-6-2-7-13-23)28-21-32(20-22-10-4-1-5-11-22)29-17-16-25(33(35)36)18-27(28)29/h1-2,4-7,10-13,16-18,21,24,26H,3,8-9,14-15,19-20H2,(H,31,34)/t26-/m1/s1 |
| InChIKey | KLQRIFXBYQNDHA-AREMUKBSSA-N |
| XLogP | 6.57 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|