C33H39N3O2 — CID 92912022
(3R)-3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 92912022) has the molecular formula C33H39N3O2 and a molecular weight of 509.69 g/mol. Its IUPAC name is (3R)-3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | (3R)-3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 92912022 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | (3R)-3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | Cc1ccc(Cn2cc([C@H](CC(=O)NCCCN3CCOCC3)c3cccc(C)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H39N3O2/c1-25-11-13-27(14-12-25)23-36-24-31(29-9-3-4-10-32(29)36)30(28-8-5-7-26(2)21-28)22-33(37)34-15-6-16-35-17-19-38-20-18-35/h3-5,7-14,21,24,30H,6,15-20,22-23H2,1-2H3,(H,34,37)/t30-/m1/s1 |
| InChIKey | DMADQLUXQANZOD-SSEXGKCCSA-N |
| XLogP | 5.67 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|