C30H24F3N3O4 — CID 83279167
3-(1-benzyl-5-nitroindol-3-yl)-N-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 83279167) has the molecular formula C30H24F3N3O4 and a molecular weight of 547.53 g/mol. Its IUPAC name is 3-(1-benzyl-5-nitroindol-3-yl)-N-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(1-benzyl-5-nitroindol-3-yl)-N-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 83279167 |
| Molecular Formula | C30H24F3N3O4 |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 3-(1-benzyl-5-nitroindol-3-yl)-N-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CC(c1ccc(C(F)(F)F)cc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NCc1ccco1 |
| InChI | InChI=1S/C30H24F3N3O4/c31-30(32,33)22-10-8-21(9-11-22)25(16-29(37)34-17-24-7-4-14-40-24)27-19-35(18-20-5-2-1-3-6-20)28-13-12-23(36(38)39)15-26(27)28/h1-15,19,25H,16-18H2,(H,34,37) |
| InChIKey | KKPHHGHERYBZIO-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|