C29H28F3N3O4 — CID 83287624
N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]-5-nitroindol-3-yl]-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 83287624) has the molecular formula C29H28F3N3O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]-5-nitroindol-3-yl]-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]-5-nitroindol-3-yl]-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 83287624 |
| Molecular Formula | C29H28F3N3O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]-5-nitroindol-3-yl]-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | COCCNC(=O)CC(c1ccc(C(F)(F)F)cc1)c1cn(Cc2ccc(C)cc2)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C29H28F3N3O4/c1-19-3-5-20(6-4-19)17-34-18-26(25-15-23(35(37)38)11-12-27(25)34)24(16-28(36)33-13-14-39-2)21-7-9-22(10-8-21)29(30,31)32/h3-12,15,18,24H,13-14,16-17H2,1-2H3,(H,33,36) |
| InChIKey | IUEXMZPGZKJCEY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|