C28H27F3N2O2 — CID 98670351
(3S)-3-(1-benzylindol-3-yl)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 98670351) has the molecular formula C28H27F3N2O2 and a molecular weight of 480.53 g/mol. Its IUPAC name is (3S)-3-(1-benzylindol-3-yl)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (3S)-3-(1-benzylindol-3-yl)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 98670351 |
| Molecular Formula | C28H27F3N2O2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (3S)-3-(1-benzylindol-3-yl)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | COCCNC(=O)C[C@@H](c1ccc(C(F)(F)F)cc1)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H27F3N2O2/c1-35-16-15-32-27(34)17-24(21-11-13-22(14-12-21)28(29,30)31)25-19-33(18-20-7-3-2-4-8-20)26-10-6-5-9-23(25)26/h2-14,19,24H,15-18H2,1H3,(H,32,34)/t24-/m0/s1 |
| InChIKey | APGUDYUOEVCRHD-DEOSSOPVSA-N |
| XLogP | 5.99 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|