C32H28F3N3O — CID 90488623
3-(1-benzylindol-3-yl)-N-(2-pyridin-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 90488623) has the molecular formula C32H28F3N3O and a molecular weight of 527.59 g/mol. Its IUPAC name is 3-(1-benzylindol-3-yl)-N-(2-pyridin-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(1-benzylindol-3-yl)-N-(2-pyridin-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 90488623 |
| Molecular Formula | C32H28F3N3O |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 3-(1-benzylindol-3-yl)-N-(2-pyridin-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CC(c1ccc(C(F)(F)F)cc1)c1cn(Cc2ccccc2)c2ccccc12)NCCc1ccccn1 |
| InChI | InChI=1S/C32H28F3N3O/c33-32(34,35)25-15-13-24(14-16-25)28(20-31(39)37-19-17-26-10-6-7-18-36-26)29-22-38(21-23-8-2-1-3-9-23)30-12-5-4-11-27(29)30/h1-16,18,22,28H,17,19-21H2,(H,37,39) |
| InChIKey | MPHQBNINXZEHRS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |