C31H34N2O — CID 3980086
3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-1-piperidin-1-ylpropan-1-one (PubChem CID 3980086) has the molecular formula C31H34N2O and a molecular weight of 450.63 g/mol. Its IUPAC name is 3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-1-piperidin-1-ylpropan-1-one.
| Compound Name | 3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 3980086 |
| Molecular Formula | C31H34N2O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 3-(3-methylphenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-1-piperidin-1-ylpropan-1-one |
| SMILES | Cc1ccc(Cn2cc(C(CC(=O)N3CCCCC3)c3cccc(C)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H34N2O/c1-23-13-15-25(16-14-23)21-33-22-29(27-11-4-5-12-30(27)33)28(26-10-8-9-24(2)19-26)20-31(34)32-17-6-3-7-18-32/h4-5,8-16,19,22,28H,3,6-7,17-18,20-21H2,1-2H3 |
| InChIKey | NXSYWXXTKUZBMK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |