C30H33FN2O — CID 93002169
(3R)-3-(4-fluorophenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-pentylpropanamide (PubChem CID 93002169) has the molecular formula C30H33FN2O and a molecular weight of 456.61 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-pentylpropanamide.
| Compound Name | (3R)-3-(4-fluorophenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 93002169 |
| Molecular Formula | C30H33FN2O |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)C[C@H](c1ccc(F)cc1)c1cn(Cc2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C30H33FN2O/c1-3-4-7-18-32-30(34)19-27(24-14-16-25(31)17-15-24)28-21-33(29-9-6-5-8-26(28)29)20-23-12-10-22(2)11-13-23/h5-6,8-17,21,27H,3-4,7,18-20H2,1-2H3,(H,32,34)/t27-/m1/s1 |
| InChIKey | WZNCMOPNAAKXSO-HHHXNRCGSA-N |
| XLogP | 6.97 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|