C22H23F3N2O — CID 42803917
N-butyl-3-(1H-indol-3-yl)-3-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 42803917) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is N-butyl-3-(1H-indol-3-yl)-3-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-butyl-3-(1H-indol-3-yl)-3-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42803917 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-butyl-3-(1H-indol-3-yl)-3-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCCCNC(=O)CC(c1ccccc1C(F)(F)F)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H23F3N2O/c1-2-3-12-26-21(28)13-17(15-8-4-6-10-19(15)22(23,24)25)18-14-27-20-11-7-5-9-16(18)20/h4-11,14,17,27H,2-3,12-13H2,1H3,(H,26,28) |
| InChIKey | ASIAQELIPDJTIZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|