C26H24F3N3O — CID 42803891
3-(7-ethyl-1H-indol-3-yl)-N-(pyridin-4-ylmethyl)-3-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 42803891) has the molecular formula C26H24F3N3O and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-(7-ethyl-1H-indol-3-yl)-N-(pyridin-4-ylmethyl)-3-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(7-ethyl-1H-indol-3-yl)-N-(pyridin-4-ylmethyl)-3-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42803891 |
| Molecular Formula | C26H24F3N3O |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-(7-ethyl-1H-indol-3-yl)-N-(pyridin-4-ylmethyl)-3-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NCc3ccncc3)c3ccccc3C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C26H24F3N3O/c1-2-18-6-5-8-20-22(16-32-25(18)20)21(19-7-3-4-9-23(19)26(27,28)29)14-24(33)31-15-17-10-12-30-13-11-17/h3-13,16,21,32H,2,14-15H2,1H3,(H,31,33) |
| InChIKey | LLNVIPLYVSGJDE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |