C23H23ClN2O — CID 9425337
N-[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide (PubChem CID 9425337) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 9425337 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide |
| SMILES | O=C(C[C@@H]1C=CCC1)NC[C@@H](c1ccccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H23ClN2O/c24-21-11-5-3-9-17(21)19(15-26-23(27)13-16-7-1-2-8-16)20-14-25-22-12-6-4-10-18(20)22/h1,3-7,9-12,14,16,19,25H,2,8,13,15H2,(H,26,27)/t16-,19+/m1/s1 |
| InChIKey | ZWMZONMZJQCVKA-APWZRJJASA-N |
| XLogP | 5.43 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|