C20H18ClN3O3 — CID 98681469
trans-(1R,2R)-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 98681469) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 98681469 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | trans-(1R,2R)-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | O=C(NC[C@H](c1ccccc1Cl)c1c[nH]c2ccccc12)[C@@H]1C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18ClN3O3/c21-17-7-3-1-5-12(17)15(11-23-20(25)14-9-19(14)24(26)27)16-10-22-18-8-4-2-6-13(16)18/h1-8,10,14-15,19,22H,9,11H2,(H,23,25)/t14-,15-,19-/m1/s1 |
| InChIKey | ICBSIEOIQLMMSU-SPYBWZPUSA-N |
| XLogP | 3.73 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|