C25H21ClN4O4 — CID 55351916
N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 55351916) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55351916 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | O=C(CNC(=O)c1cccc([N+](=O)[O-])c1)NCC(c1ccccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H21ClN4O4/c26-22-10-3-1-8-18(22)20(21-13-27-23-11-4-2-9-19(21)23)14-28-24(31)15-29-25(32)16-6-5-7-17(12-16)30(33)34/h1-13,20,27H,14-15H2,(H,28,31)(H,29,32) |
| InChIKey | MPSQQJRWCURCSG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|