C26H23ClN4O4 — CID 24629049
N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide (PubChem CID 24629049) has the molecular formula C26H23ClN4O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 24629049 |
| Molecular Formula | C26H23ClN4O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[2-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)NCC(c2ccccc2Cl)c2c[nH]c3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H23ClN4O4/c1-16-10-11-17(12-24(16)31(34)35)26(33)30-15-25(32)29-14-20(18-6-2-4-8-22(18)27)21-13-28-23-9-5-3-7-19(21)23/h2-13,20,28H,14-15H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | RAJMKXRTPCAENS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|