C20H23ClN4O4 — CID 112768661
N-[2-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide (PubChem CID 112768661) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-[2-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[2-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 112768661 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[2-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCC(=O)NCC(c2ccccc2Cl)N(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23ClN4O4/c1-13-10-14(8-9-17(13)25(28)29)20(27)23-12-19(26)22-11-18(24(2)3)15-6-4-5-7-16(15)21/h4-10,18H,11-12H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | LWQJJCVXBWBOPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|