C19H20ClN3O5 — CID 46654579
methyl 3-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]carbamoyl]-5-nitrobenzoate (PubChem CID 46654579) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is methyl 3-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 46654579 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | methyl 3-[[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)NCC(c2ccccc2Cl)N(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20ClN3O5/c1-22(2)17(15-6-4-5-7-16(15)20)11-21-18(24)12-8-13(19(25)28-3)10-14(9-12)23(26)27/h4-10,17H,11H2,1-3H3,(H,21,24) |
| InChIKey | SLLHYHPDPIPLSI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|