C17H19ClN2O2 — CID 51866833
N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-hydroxybenzamide (PubChem CID 51866833) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-hydroxybenzamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 51866833 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-hydroxybenzamide |
| SMILES | CN(C)[C@@H](CNC(=O)c1ccccc1O)c1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O2/c1-20(2)15(12-7-3-5-9-14(12)18)11-19-17(22)13-8-4-6-10-16(13)21/h3-10,15,21H,11H2,1-2H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | IHUWUPBHOQXJMM-HNNXBMFYSA-N |
| XLogP | 3.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |