C18H22ClN3O4S — CID 25494157
N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 25494157) has the molecular formula C18H22ClN3O4S and a molecular weight of 411.91 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 25494157 |
| Molecular Formula | C18H22ClN3O4S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NC[C@@H](c1ccccc1Cl)N(C)C |
| InChI | InChI=1S/C18H22ClN3O4S/c1-22(2)16(13-6-4-5-7-15(13)19)11-21-18(23)14-10-12(27(20,24)25)8-9-17(14)26-3/h4-10,16H,11H2,1-3H3,(H,21,23)(H2,20,24,25)/t16-/m0/s1 |
| InChIKey | BTRVVHIBTNMHBK-INIZCTEOSA-N |
| XLogP | 2.03 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |