C19H25ClN2O3 — CID 52985226
N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-methoxybenzamide;hydrochloride (PubChem CID 52985226) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-methoxybenzamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 52985226 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-2-methoxybenzamide;hydrochloride |
| SMILES | COc1ccccc1C(=O)NCC(c1ccccc1OC)N(C)C.Cl |
| InChI | InChI=1S/C19H24N2O3.ClH/c1-21(2)16(14-9-5-7-11-17(14)23-3)13-20-19(22)15-10-6-8-12-18(15)24-4;/h5-12,16H,13H2,1-4H3,(H,20,22);1H |
| InChIKey | XXFGOLYXZXQOCN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |