C16H21ClN2O2S — CID 52985337
N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 52985337) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 52985337 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | COc1ccccc1C(CNC(=O)c1cccs1)N(C)C.Cl |
| InChI | InChI=1S/C16H20N2O2S.ClH/c1-18(2)13(12-7-4-5-8-14(12)20-3)11-17-16(19)15-9-6-10-21-15;/h4-10,13H,11H2,1-3H3,(H,17,19);1H |
| InChIKey | JPYSVWYTPUMKNW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |