C20H24ClN3O6 — CID 25489476
N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 25489476) has the molecular formula C20H24ClN3O6 and a molecular weight of 437.88 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 25489476 |
| Molecular Formula | C20H24ClN3O6 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC[C@H](c2ccccc2Cl)N(C)C)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C20H24ClN3O6/c1-23(2)15(12-8-6-7-9-14(12)21)11-22-20(25)13-10-16(28-3)18(29-4)19(30-5)17(13)24(26)27/h6-10,15H,11H2,1-5H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | CBSKMPLAGNQNKN-OAHLLOKOSA-N |
| XLogP | 3.31 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|