C20H24N2O7 — CID 55588364
3,4,5-trimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methyl-2-nitrobenzamide (PubChem CID 55588364) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methyl-2-nitrobenzamide.
| Compound Name | 3,4,5-trimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 55588364 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methyl-2-nitrobenzamide |
| SMILES | COc1ccccc1C(C)N(C)C(=O)c1cc(OC)c(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N2O7/c1-12(13-9-7-8-10-15(13)26-3)21(2)20(23)14-11-16(27-4)18(28-5)19(29-6)17(14)22(24)25/h7-12H,1-6H3 |
| InChIKey | WYGOTVRHIKCVDG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|