C19H23NO4 — CID 74627130
2,5-dimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylbenzamide (PubChem CID 74627130) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylbenzamide.
| Compound Name | 2,5-dimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 74627130 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2,5-dimethoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylbenzamide |
| SMILES | COc1ccc(OC)c(C(=O)N(C)C(C)c2ccccc2OC)c1 |
| InChI | InChI=1S/C19H23NO4/c1-13(15-8-6-7-9-17(15)23-4)20(2)19(21)16-12-14(22-3)10-11-18(16)24-5/h6-13H,1-5H3 |
| InChIKey | HHLSXUASTOCXEE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |