C14H18N2O3 — CID 63224778
N-(1-cyanopropan-2-yl)-2,5-dimethoxy-N-methylbenzamide (PubChem CID 63224778) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-2,5-dimethoxy-N-methylbenzamide.
| Compound Name | N-(1-cyanopropan-2-yl)-2,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 63224778 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-2,5-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(OC)c(C(=O)N(C)C(C)CC#N)c1 |
| InChI | InChI=1S/C14H18N2O3/c1-10(7-8-15)16(2)14(17)12-9-11(18-3)5-6-13(12)19-4/h5-6,9-10H,7H2,1-4H3 |
| InChIKey | ZQBMOFXERGRUJW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |