C13H20N2O3 — CID 112701391
N-(1-aminopropan-2-yl)-2,4-dimethoxy-N-methylbenzamide (PubChem CID 112701391) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2,4-dimethoxy-N-methylbenzamide.
| Compound Name | N-(1-aminopropan-2-yl)-2,4-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 112701391 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2,4-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)C(C)CN)c(OC)c1 |
| InChI | InChI=1S/C13H20N2O3/c1-9(8-14)15(2)13(16)11-6-5-10(17-3)7-12(11)18-4/h5-7,9H,8,14H2,1-4H3 |
| InChIKey | TZEBAKQPZSUGBN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |