C14H22N2O4 — CID 104556591
N-(1-aminopropan-2-yl)-2,3,4-trimethoxy-N-methylbenzamide (PubChem CID 104556591) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2,3,4-trimethoxy-N-methylbenzamide.
| Compound Name | N-(1-aminopropan-2-yl)-2,3,4-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 104556591 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2,3,4-trimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)C(C)CN)c(OC)c1OC |
| InChI | InChI=1S/C14H22N2O4/c1-9(8-15)16(2)14(17)10-6-7-11(18-3)13(20-5)12(10)19-4/h6-7,9H,8,15H2,1-5H3 |
| InChIKey | JUKKZIKOQUXQQG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |