C23H28N2O6 — CID 37007930
N-cyclopropyl-3,4,5-trimethoxy-2-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide (PubChem CID 37007930) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-cyclopropyl-3,4,5-trimethoxy-2-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide.
| Compound Name | N-cyclopropyl-3,4,5-trimethoxy-2-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 37007930 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-cyclopropyl-3,4,5-trimethoxy-2-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide |
| SMILES | COc1cc(C(=O)N(Cc2ccc(C(C)C)cc2)C2CC2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C23H28N2O6/c1-14(2)16-8-6-15(7-9-16)13-24(17-10-11-17)23(26)18-12-19(29-3)21(30-4)22(31-5)20(18)25(27)28/h6-9,12,14,17H,10-11,13H2,1-5H3 |
| InChIKey | WWJKKJUZJNLXCF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|