C16H24N2O6 — CID 37346399
N-butyl-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 37346399) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-butyl-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-butyl-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 37346399 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-butyl-N-ethyl-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | CCCCN(CC)C(=O)c1cc(OC)c(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N2O6/c1-6-8-9-17(7-2)16(19)11-10-12(22-3)14(23-4)15(24-5)13(11)18(20)21/h10H,6-9H2,1-5H3 |
| InChIKey | OBGKSWKPIOJGRC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|