C15H20N2O8 — CID 55609543
methyl 2-methyl-2-[(3,4,5-trimethoxy-2-nitrobenzoyl)amino]propanoate (PubChem CID 55609543) has the molecular formula C15H20N2O8 and a molecular weight of 356.33 g/mol. Its IUPAC name is methyl 2-methyl-2-[(3,4,5-trimethoxy-2-nitrobenzoyl)amino]propanoate.
| Compound Name | methyl 2-methyl-2-[(3,4,5-trimethoxy-2-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55609543 |
| Molecular Formula | C15H20N2O8 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | methyl 2-methyl-2-[(3,4,5-trimethoxy-2-nitrobenzoyl)amino]propanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)c1cc(OC)c(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O8/c1-15(2,14(19)25-6)16-13(18)8-7-9(22-3)11(23-4)12(24-5)10(8)17(20)21/h7H,1-6H3,(H,16,18) |
| InChIKey | FUOHRTQUCVOTPO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|