C17H17FN2O6 — CID 46424831
N-[(3-fluorophenyl)methyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 46424831) has the molecular formula C17H17FN2O6 and a molecular weight of 364.33 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 46424831 |
| Molecular Formula | C17H17FN2O6 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCc2cccc(F)c2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C17H17FN2O6/c1-24-13-8-12(14(20(22)23)16(26-3)15(13)25-2)17(21)19-9-10-5-4-6-11(18)7-10/h4-8H,9H2,1-3H3,(H,19,21) |
| InChIKey | VSQDTPVWACMWGT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|