C25H33N3O6 — CID 51953699
N-[[4-[[(3S,5R)-3,5-dimethylpiperidin-1-yl]methyl]phenyl]methyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 51953699) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[[4-[[(3S,5R)-3,5-dimethylpiperidin-1-yl]methyl]phenyl]methyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[[4-[[(3S,5R)-3,5-dimethylpiperidin-1-yl]methyl]phenyl]methyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 51953699 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[[4-[[(3S,5R)-3,5-dimethylpiperidin-1-yl]methyl]phenyl]methyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(CN3C[C@H](C)C[C@H](C)C3)cc2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C25H33N3O6/c1-16-10-17(2)14-27(13-16)15-19-8-6-18(7-9-19)12-26-25(29)20-11-21(32-3)23(33-4)24(34-5)22(20)28(30)31/h6-9,11,16-17H,10,12-15H2,1-5H3,(H,26,29)/t16-,17+ |
| InChIKey | WPFDMWPKWUQUIY-CALCHBBNSA-N |
| XLogP | 4.03 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|