C19H29N3O6 — CID 94867137
3,4,5-trimethoxy-N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-2-nitrobenzamide (PubChem CID 94867137) has the molecular formula C19H29N3O6 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-2-nitrobenzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 94867137 |
| Molecular Formula | C19H29N3O6 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC[C@@H](C)N2CCC[C@H](C)C2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C19H29N3O6/c1-12-7-6-8-21(11-12)13(2)10-20-19(23)14-9-15(26-3)17(27-4)18(28-5)16(14)22(24)25/h9,12-13H,6-8,10-11H2,1-5H3,(H,20,23)/t12-,13+/m0/s1 |
| InChIKey | LQHHIJNJYFFVFP-QWHCGFSZSA-N |
| XLogP | 2.47 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|