C22H26ClN3O3 — CID 60515982
4-chloro-N-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-nitrobenzamide (PubChem CID 60515982) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 4-chloro-N-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 60515982 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-chloro-N-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-nitrobenzamide |
| SMILES | CC1CC(C)CN(Cc2ccc(CNC(=O)c3ccc(Cl)cc3[N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-15-9-16(2)13-25(12-15)14-18-5-3-17(4-6-18)11-24-22(27)20-8-7-19(23)10-21(20)26(28)29/h3-8,10,15-16H,9,11-14H2,1-2H3,(H,24,27) |
| InChIKey | CGSLVWDNUZQEFD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|