C18H18ClFN2O7 — CID 97249293
N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 97249293) has the molecular formula C18H18ClFN2O7 and a molecular weight of 428.80 g/mol. Its IUPAC name is N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 97249293 |
| Molecular Formula | C18H18ClFN2O7 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC[C@@H](O)c2ccc(Cl)c(F)c2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C18H18ClFN2O7/c1-27-14-7-10(15(22(25)26)17(29-3)16(14)28-2)18(24)21-8-13(23)9-4-5-11(19)12(20)6-9/h4-7,13,23H,8H2,1-3H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | VTXLHNQGFLTVGN-CYBMUJFWSA-N |
| XLogP | 2.88 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|