C14H20INO4 — CID 138964223
N,N-diethyl-2-iodo-3,4,5-trimethoxybenzamide (PubChem CID 138964223) has the molecular formula C14H20INO4 and a molecular weight of 393.22 g/mol. Its IUPAC name is N,N-diethyl-2-iodo-3,4,5-trimethoxybenzamide.
| Compound Name | N,N-diethyl-2-iodo-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 138964223 |
| Molecular Formula | C14H20INO4 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N,N-diethyl-2-iodo-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(OC)c(OC)c(OC)c1I |
| InChI | InChI=1S/C14H20INO4/c1-6-16(7-2)14(17)9-8-10(18-3)12(19-4)13(20-5)11(9)15/h8H,6-7H2,1-5H3 |
| InChIKey | RKZTVRZXUZGSRZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|