C14H21NO3 — CID 12637452
N,N-diethyl-3,5-dimethoxy-2-methylbenzamide (PubChem CID 12637452) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N,N-diethyl-3,5-dimethoxy-2-methylbenzamide.
| Compound Name | N,N-diethyl-3,5-dimethoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 12637452 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N,N-diethyl-3,5-dimethoxy-2-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(OC)cc(OC)c1C |
| InChI | InChI=1S/C14H21NO3/c1-6-15(7-2)14(16)12-8-11(17-4)9-13(18-5)10(12)3/h8-9H,6-7H2,1-5H3 |
| InChIKey | OHPCXNIHPPGEGZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |