C15H16Cl2N2OS — CID 42910726
5-chloro-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]thiophene-2-carboxamide (PubChem CID 42910726) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42910726 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 5-chloro-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]thiophene-2-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(Cl)s1)c1ccccc1Cl |
| InChI | InChI=1S/C15H16Cl2N2OS/c1-19(2)12(10-5-3-4-6-11(10)16)9-18-15(20)13-7-8-14(17)21-13/h3-8,12H,9H2,1-2H3,(H,18,20) |
| InChIKey | VOCSSNYFVUIOAV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |