C15H19N3O6 — CID 120528000
2,2-dimethyl-3-[[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]amino]propanoic acid (PubChem CID 120528000) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 120528000 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2,2-dimethyl-3-[[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]amino]propanoic acid |
| SMILES | Cc1cc(C(=O)NCC(=O)NCC(C)(C)C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O6/c1-9-6-10(4-5-11(9)18(23)24)13(20)16-7-12(19)17-8-15(2,3)14(21)22/h4-6H,7-8H2,1-3H3,(H,16,20)(H,17,19)(H,21,22) |
| InChIKey | RBVXPOAEINNIBF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|