C27H27N3O2S — CID 51479387
N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 51479387) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51479387 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccccc1)c1c[nH]c2ccccc12)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C27H27N3O2S/c31-26(20-12-14-30(15-13-20)27(32)25-11-6-16-33-25)29-17-22(19-7-2-1-3-8-19)23-18-28-24-10-5-4-9-21(23)24/h1-11,16,18,20,22,28H,12-15,17H2,(H,29,31)/t22-/m0/s1 |
| InChIKey | QLRVRMSEXSDZRX-QFIPXVFZSA-N |
| XLogP | 5.03 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |