C21H17BrN2OS — CID 35124002
N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide (PubChem CID 35124002) has the molecular formula C21H17BrN2OS and a molecular weight of 425.35 g/mol. Its IUPAC name is N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 35124002 |
| Molecular Formula | C21H17BrN2OS |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N-[(2S)-2-(4-bromophenyl)-2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccc(Br)cc1)c1c[nH]c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C21H17BrN2OS/c22-15-9-7-14(8-10-15)17(12-24-21(25)20-6-3-11-26-20)18-13-23-19-5-2-1-4-16(18)19/h1-11,13,17,23H,12H2,(H,24,25)/t17-/m0/s1 |
| InChIKey | BIXPHAMUJVJKNN-KRWDZBQOSA-N |
| XLogP | 5.55 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |