C22H19BrN2OS — CID 27770907
2-(4-bromophenyl)-N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]acetamide (PubChem CID 27770907) has the molecular formula C22H19BrN2OS and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 27770907 |
| Molecular Formula | C22H19BrN2OS |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)NC[C@H](c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H19BrN2OS/c23-16-9-7-15(8-10-16)12-22(26)25-14-19(21-6-3-11-27-21)18-13-24-20-5-2-1-4-17(18)20/h1-11,13,19,24H,12,14H2,(H,25,26)/t19-/m0/s1 |
| InChIKey | JXXFNQAWQZCZPK-IBGZPJMESA-N |
| XLogP | 5.48 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |