C27H31N3O2S — CID 55370138
N-[2-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 55370138) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is N-[2-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55370138 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[2-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12CC3CC(CC(C3)C1)C2)NCC(c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H31N3O2S/c31-25(16-30-26(32)27-11-17-8-18(12-27)10-19(9-17)13-27)29-15-22(24-6-3-7-33-24)21-14-28-23-5-2-1-4-20(21)23/h1-7,14,17-19,22,28H,8-13,15-16H2,(H,29,31)(H,30,32) |
| InChIKey | GQXATROYOPWZHJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |