C23H19F3N2OS — CID 26729750
N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 26729750) has the molecular formula C23H19F3N2OS and a molecular weight of 428.48 g/mol. Its IUPAC name is N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 26729750 |
| Molecular Formula | C23H19F3N2OS |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)NC[C@@H](c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H19F3N2OS/c24-23(25,26)16-6-3-5-15(11-16)12-22(29)28-14-19(21-9-4-10-30-21)18-13-27-20-8-2-1-7-17(18)20/h1-11,13,19,27H,12,14H2,(H,28,29)/t19-/m1/s1 |
| InChIKey | BBLVHFLMOYPYTI-LJQANCHMSA-N |
| XLogP | 5.74 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |