C21H16F2N2OS — CID 42904645
2,6-difluoro-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzamide (PubChem CID 42904645) has the molecular formula C21H16F2N2OS and a molecular weight of 382.44 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 42904645 |
| Molecular Formula | C21H16F2N2OS |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2,6-difluoro-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzamide |
| SMILES | O=C(NCC(c1cccs1)c1c[nH]c2ccccc12)c1c(F)cccc1F |
| InChI | InChI=1S/C21H16F2N2OS/c22-16-6-3-7-17(23)20(16)21(26)25-12-15(19-9-4-10-27-19)14-11-24-18-8-2-1-5-13(14)18/h1-11,15,24H,12H2,(H,25,26) |
| InChIKey | PKGSCDLAWXPDCS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |