C21H19FN2S — CID 97014263
(2S)-N-[(2-fluorophenyl)methyl]-2-(1H-indol-3-yl)-2-thiophen-2-ylethanamine (PubChem CID 97014263) has the molecular formula C21H19FN2S and a molecular weight of 350.46 g/mol. Its IUPAC name is (2S)-N-[(2-fluorophenyl)methyl]-2-(1H-indol-3-yl)-2-thiophen-2-ylethanamine.
| Compound Name | (2S)-N-[(2-fluorophenyl)methyl]-2-(1H-indol-3-yl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 97014263 |
| Molecular Formula | C21H19FN2S |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2S)-N-[(2-fluorophenyl)methyl]-2-(1H-indol-3-yl)-2-thiophen-2-ylethanamine |
| SMILES | Fc1ccccc1CNC[C@@H](c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19FN2S/c22-19-8-3-1-6-15(19)12-23-13-18(21-10-5-11-25-21)17-14-24-20-9-4-2-7-16(17)20/h1-11,14,18,23-24H,12-13H2/t18-/m1/s1 |
| InChIKey | MNQAKYBMDYFJEE-GOSISDBHSA-N |
| XLogP | 5.29 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |