C24H24FN3OS — CID 55472337
1-[1-(4-fluorophenyl)ethyl]-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-1-methylurea (PubChem CID 55472337) has the molecular formula C24H24FN3OS and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)ethyl]-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-1-methylurea.
| Compound Name | 1-[1-(4-fluorophenyl)ethyl]-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-1-methylurea |
|---|---|
| PubChem CID | 55472337 |
| Molecular Formula | C24H24FN3OS |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-[1-(4-fluorophenyl)ethyl]-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-1-methylurea |
| SMILES | CC(c1ccc(F)cc1)N(C)C(=O)NCC(c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H24FN3OS/c1-16(17-9-11-18(25)12-10-17)28(2)24(29)27-15-21(23-8-5-13-30-23)20-14-26-22-7-4-3-6-19(20)22/h3-14,16,21,26H,15H2,1-2H3,(H,27,29) |
| InChIKey | KGOZHHSALQSDDR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |