C16H15NOS — CID 102274489
(4R)-4-(1H-indol-3-yl)-4-thiophen-2-ylbutan-2-one (PubChem CID 102274489) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is (4R)-4-(1H-indol-3-yl)-4-thiophen-2-ylbutan-2-one.
| Compound Name | (4R)-4-(1H-indol-3-yl)-4-thiophen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 102274489 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (4R)-4-(1H-indol-3-yl)-4-thiophen-2-ylbutan-2-one |
| SMILES | CC(=O)C[C@@H](c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H15NOS/c1-11(18)9-13(16-7-4-8-19-16)14-10-17-15-6-3-2-5-12(14)15/h2-8,10,13,17H,9H2,1H3/t13-/m1/s1 |
| InChIKey | RVCQVQKWNIMYSK-CYBMUJFWSA-N |
| XLogP | 4.34 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |