C21H25N3OS — CID 9452151
(2R)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 9452151) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2R)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 9452151 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2R)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C[C@@H](NC[C@H](c1cccs1)c1c[nH]c2ccccc12)C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H25N3OS/c1-15(21(25)24-10-4-5-11-24)22-14-18(20-9-6-12-26-20)17-13-23-19-8-3-2-7-16(17)19/h2-3,6-9,12-13,15,18,22-23H,4-5,10-11,14H2,1H3/t15-,18+/m1/s1 |
| InChIKey | SSDJHXCDVCEQKR-QAPCUYQASA-N |
| XLogP | 3.96 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |