C23H22FN3OS — CID 8645674
(2S)-N-(4-fluorophenyl)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]propanamide (PubChem CID 8645674) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is (2S)-N-(4-fluorophenyl)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]propanamide.
| Compound Name | (2S)-N-(4-fluorophenyl)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]propanamide |
|---|---|
| PubChem CID | 8645674 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (2S)-N-(4-fluorophenyl)-2-[[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]propanamide |
| SMILES | C[C@H](NC[C@H](c1cccs1)c1c[nH]c2ccccc12)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3OS/c1-15(23(28)27-17-10-8-16(24)9-11-17)25-14-20(22-7-4-12-29-22)19-13-26-21-6-3-2-5-18(19)21/h2-13,15,20,25-26H,14H2,1H3,(H,27,28)/t15-,20-/m0/s1 |
| InChIKey | WCJDGKDREGFHCY-YWZLYKJASA-N |
| XLogP | 5.12 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |