C21H18FN3OS — CID 24588097
1-(2-fluorophenyl)-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]urea (PubChem CID 24588097) has the molecular formula C21H18FN3OS and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 24588097 |
| Molecular Formula | C21H18FN3OS |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]urea |
| SMILES | O=C(NCC(c1cccs1)c1c[nH]c2ccccc12)Nc1ccccc1F |
| InChI | InChI=1S/C21H18FN3OS/c22-17-7-2-4-9-19(17)25-21(26)24-13-16(20-10-5-11-27-20)15-12-23-18-8-3-1-6-14(15)18/h1-12,16,23H,13H2,(H2,24,25,26) |
| InChIKey | XJQPLXLBRNRATN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |